Products 23550-28-9

CAS 23550-28-9 is the registry number for 1,1-Di-tert-butyl 2-ethyl ethane-1,1,2-tricarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O,1-O-ditert-butyl 2-O-ethyl ethane-1,1,2-tricarboxylate (CAS 23550-28-9) is a chemical compound with the molecular formula C15H26O6 and a molecular weight of 302.36 g/mol. IUPAC name: 1-O,1-O-ditert-butyl 2-O-ethyl ethane-1,1,2-tricarboxylate. InChIKey: UHWMYQZIMKZKBL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26O6
Molecular weight302.36 g/mol
IUPAC name1-O,1-O-ditert-butyl 2-O-ethyl ethane-1,1,2-tricarboxylate
InChIKeyUHWMYQZIMKZKBL-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)