CAS 1025209-24-8 is the registry number for 2-acetyl-3-indolinyl-N-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(2E)-2-(2,3-dihydroindol-1-ylmethylidene)-3-oxo-N-phenylbutanamide (CAS 1025209-24-8) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: (2E)-2-(2,3-dihydroindol-1-ylmethylidene)-3-oxo-N-phenylbutanamide. InChIKey: IVPIIXPMQRZPCU-GHRIWEEISA-N.
| Molecular formula | C19H18N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | (2E)-2-(2,3-dihydroindol-1-ylmethylidene)-3-oxo-N-phenylbutanamide |
| InChIKey | IVPIIXPMQRZPCU-GHRIWEEISA-N |
| SMILES | CC(=O)/C(=C\N1CCC2=CC=CC=C21)/C(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)