Products 1025316-11-3
CAS 1025316-11-3 is the registry number for 3-(N-(4-(2-pyridylthio)phenyl)carbamoyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-4-oxo-4-(4-pyridin-2-ylsulfanylanilino)but-2-enoic acid (CAS 1025316-11-3) is a chemical compound with the molecular formula C15H12N2O3S and a molecular weight of 300.3 g/mol. IUPAC name: (E)-4-oxo-4-(4-pyridin-2-ylsulfanylanilino)but-2-enoic acid. InChIKey: WRKYAWARUKETGX-CMDGGOBGSA-N.
| Molecular formula | C15H12N2O3S |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | (E)-4-oxo-4-(4-pyridin-2-ylsulfanylanilino)but-2-enoic acid |
| InChIKey | WRKYAWARUKETGX-CMDGGOBGSA-N |
| SMILES | C1=CC=NC(=C1)SC2=CC=C(C=C2)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)