CAS 681260-55-9 is the registry number for Methyl 3-amino-5-(3-phenylisoxazol-5-yl)thiophene-2-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-amino-5-(3-phenyl-1,2-oxazol-5-yl)thiophene-2-carboxylate (CAS 681260-55-9) is a chemical compound with the molecular formula C15H12N2O3S and a molecular weight of 300.3 g/mol. IUPAC name: methyl 3-amino-5-(3-phenyl-1,2-oxazol-5-yl)thiophene-2-carboxylate. InChIKey: HICQQMCAFMVRJH-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3S |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | methyl 3-amino-5-(3-phenyl-1,2-oxazol-5-yl)thiophene-2-carboxylate |
| InChIKey | HICQQMCAFMVRJH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC(=NO2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)