Products 752244-07-8

CAS 752244-07-8 is the registry number for Ethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS 752244-07-8) is a chemical compound with the molecular formula C15H12N2O3S and a molecular weight of 300.3 g/mol. IUPAC name: ethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate. InChIKey: OUMJASWUOHDNRI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12N2O3S
Molecular weight300.3 g/mol
IUPAC nameethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate
InChIKeyOUMJASWUOHDNRI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC2=NC(=C(N12)C=O)C3=CC=CC=C3

Computed by PubChem (NCBI)