CAS 752244-07-8 is the registry number for Ethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate (CAS 752244-07-8) is a chemical compound with the molecular formula C15H12N2O3S and a molecular weight of 300.3 g/mol. IUPAC name: ethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate. InChIKey: OUMJASWUOHDNRI-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3S |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | ethyl 5-formyl-6-phenylimidazo[2,1-b][1,3]thiazole-3-carboxylate |
| InChIKey | OUMJASWUOHDNRI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC2=NC(=C(N12)C=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)