CAS 110926-99-3 appears in our catalog under these names: 1-Cyano-2H-benz(f)isoindole-2-ethanesulfonic Acid, 2-(1-cyano-2H-benzo(f)isoindol-2-yl)ethane-1-sulfonic acid. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-cyanobenzo[f]isoindol-2-yl)ethanesulfonic acid (CAS 110926-99-3) is a chemical compound with the molecular formula C15H12N2O3S and a molecular weight of 300.3 g/mol. IUPAC name: 2-(3-cyanobenzo[f]isoindol-2-yl)ethanesulfonic acid. InChIKey: VNSJMPGFBJGDAV-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3S |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 2-(3-cyanobenzo[f]isoindol-2-yl)ethanesulfonic acid |
| InChIKey | VNSJMPGFBJGDAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=CN(C(=C3C=C2C=C1)C#N)CCS(=O)(=O)O |
Computed by PubChem (NCBI)