Products 1239727-73-1

CAS 1239727-73-1 is the registry number for 4-(4-Methoxyphenyl)-2-(1h-pyrrol-1-yl)-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(4-methoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid (CAS 1239727-73-1) is a chemical compound with the molecular formula C15H12N2O3S and a molecular weight of 300.3 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid. InChIKey: GXGFCPDSXGONFF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12N2O3S
Molecular weight300.3 g/mol
IUPAC name4-(4-methoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole-5-carboxylic acid
InChIKeyGXGFCPDSXGONFF-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=C(SC(=N2)N3C=CC=C3)C(=O)O

Computed by PubChem (NCBI)