CAS 1025871-64-0 is the registry number for 1-(Carboxymethyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(carboxymethyl)-6-oxopyridine-3-carboxylic acid (CAS 1025871-64-0) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 1-(carboxymethyl)-6-oxopyridine-3-carboxylic acid. InChIKey: UZZTVORBQCDSNQ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 1-(carboxymethyl)-6-oxopyridine-3-carboxylic acid |
| InChIKey | UZZTVORBQCDSNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)