Products 1026028-96-5
CAS 1026028-96-5 is the registry number for JAK1/2 ligand 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2-anilinopyrimidin-4-yl)benzoic acid (CAS 1026028-96-5) is a chemical compound with the molecular formula C17H13N3O2 and a molecular weight of 291.30 g/mol. IUPAC name: 4-(2-anilinopyrimidin-4-yl)benzoic acid. InChIKey: WYMFCSSWFGRXIT-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O2 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 4-(2-anilinopyrimidin-4-yl)benzoic acid |
| InChIKey | WYMFCSSWFGRXIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=CC(=N2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)