Products 1026046-70-7
CAS 1026046-70-7 is the registry number for ethyl 3-((2-chloro-6-methylphenyl)amino)-2-cyanoprop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (E)-3-(2-chloro-6-methylanilino)-2-cyanoprop-2-enoate (CAS 1026046-70-7) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: ethyl (E)-3-(2-chloro-6-methylanilino)-2-cyanoprop-2-enoate. InChIKey: JAVSOUDJADNXKO-CSKARUKUSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | ethyl (E)-3-(2-chloro-6-methylanilino)-2-cyanoprop-2-enoate |
| InChIKey | JAVSOUDJADNXKO-CSKARUKUSA-N |
| SMILES | CCOC(=O)/C(=C/NC1=C(C=CC=C1Cl)C)/C#N |
Computed by PubChem (NCBI)