CAS 175137-17-4 appears in our catalog under these names: 1-(4-Chlorophenyl)-5-propyl-1H-pyrazole-4-carboxylic acid, 1-(4-Chlorophenyl)-5-propyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Chlorophenyl)-5-propyl-1H-pyrazole-4-carboxylic acid, 97% . Offered by: Fluorochem, Combi-blocks, Thermo Scientific. Available pack sizes: 250mg, 10g, 1g.
1-(4-chlorophenyl)-5-propylpyrazole-4-carboxylic acid (CAS 175137-17-4) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-propylpyrazole-4-carboxylic acid. InChIKey: RTLVBOYPVGHHGC-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-propylpyrazole-4-carboxylic acid |
| InChIKey | RTLVBOYPVGHHGC-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C=NN1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)