Products 15943-83-6
CAS 15943-83-6 is the registry number for Ethyl 1-(4-chlorophenyl)-3-methylpyrazole-5-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Ethyl 2-(4-chlorophenyl)-5-methylpyrazole-3-carboxylate (CAS 15943-83-6) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: ethyl 2-(4-chlorophenyl)-5-methylpyrazole-3-carboxylate. InChIKey: ZLMFYQOLMSOSLZ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | ethyl 2-(4-chlorophenyl)-5-methylpyrazole-3-carboxylate |
| InChIKey | ZLMFYQOLMSOSLZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)