CAS 386705-82-4 appears in our catalog under these names: 3-[(4-Chloro-3,5-dimethyl-1h-pyrazol-1-yl)methyl]benzoic acid, 95%, 3-((4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl)benzoic acid, 97%, 3-((4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid (CAS 386705-82-4) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: 3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid. InChIKey: GJHQJRIFWUSACQ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 3-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid |
| InChIKey | GJHQJRIFWUSACQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC(=CC=C2)C(=O)O)C)Cl |
Computed by PubChem (NCBI)