CAS 32701-92-1 appears in our catalog under these names: 2-[1-(4-Chlorophenyl)-3,5-dimethyl-1h-pyrazol-4-yl]acetic acid, 95%, 2-(1-(4-Chlorophenyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid, 95%, 2–(1–(4–Chlorophenyl)–3,5–dimethyl–1H–pyrazol–4–yl)acetic acid, 2-(1-(4-Chlorophenyl)-3,5-dimethyl-1H-pyrazol-4-yl)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 2,5g.
2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetic acid (CAS 32701-92-1) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetic acid. InChIKey: QWSDNLVYBMNSEJ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)-3,5-dimethylpyrazol-4-yl]acetic acid |
| InChIKey | QWSDNLVYBMNSEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)Cl)C)CC(=O)O |
Computed by PubChem (NCBI)