Products 1026102-76-0

CAS 1026102-76-0 is the registry number for (S,E)-2-(((Benzyloxy)carbonyl)amino)-7-ethoxy-7-oxohept-5-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-ethoxy-7-oxo-2-(phenylmethoxycarbonylamino)hept-5-enoic acid (CAS 1026102-76-0) is a chemical compound with the molecular formula C17H21NO6 and a molecular weight of 335.4 g/mol. IUPAC name: 7-ethoxy-7-oxo-2-(phenylmethoxycarbonylamino)hept-5-enoic acid. InChIKey: NKGRCDHHXUPNDB-UHFFFAOYSA-N.

Identity
Molecular formulaC17H21NO6
Molecular weight335.4 g/mol
IUPAC name7-ethoxy-7-oxo-2-(phenylmethoxycarbonylamino)hept-5-enoic acid
InChIKeyNKGRCDHHXUPNDB-UHFFFAOYSA-N
SMILESCCOC(=O)C=CCCC(C(=O)O)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)