Products 518-59-2
CAS 518-59-2 is the registry number for Hydroxylunidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(2S)-2,3-dihydroxy-3-methylbutyl]-6-methoxy-9-methyl-[1,3]dioxolo[4,5-h]quinolin-8-one (CAS 518-59-2) is a chemical compound with the molecular formula C17H21NO6 and a molecular weight of 335.4 g/mol. IUPAC name: 7-[(2S)-2,3-dihydroxy-3-methylbutyl]-6-methoxy-9-methyl-[1,3]dioxolo[4,5-h]quinolin-8-one. InChIKey: DAWBKOMKNXDZAN-LBPRGKRZSA-N.
| Molecular formula | C17H21NO6 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 7-[(2S)-2,3-dihydroxy-3-methylbutyl]-6-methoxy-9-methyl-[1,3]dioxolo[4,5-h]quinolin-8-one |
| InChIKey | DAWBKOMKNXDZAN-LBPRGKRZSA-N |
| SMILES | CC(C)([C@H](CC1=C(C2=C(C3=C(C=C2)OCO3)N(C1=O)C)OC)O)O |
Computed by PubChem (NCBI)