Products 262418-91-7
CAS 262418-91-7 appears in our catalog under these names: Dimethyl 2-Boc-isoindoline-5,6-dicarboxylate, 98%, 98%, 2-tert-Butyl 5,6-dimethyl isoindoline-2,5,6-tricarboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-O-tert-butyl 5-O,6-O-dimethyl 1,3-dihydroisoindole-2,5,6-tricarboxylate (CAS 262418-91-7) is a chemical compound with the molecular formula C17H21NO6 and a molecular weight of 335.4 g/mol. IUPAC name: 2-O-tert-butyl 5-O,6-O-dimethyl 1,3-dihydroisoindole-2,5,6-tricarboxylate. InChIKey: GPQIJDBQFBPAPV-UHFFFAOYSA-N.
| Molecular formula | C17H21NO6 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O,6-O-dimethyl 1,3-dihydroisoindole-2,5,6-tricarboxylate |
| InChIKey | GPQIJDBQFBPAPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC(=C(C=C2C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)