Products 175694-32-3
CAS 175694-32-3 is the registry number for Dimethyl cis-1-Cbz-piperidine-3,5-dicarboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-O-benzyl 3-O,5-O-dimethyl (3R,5S)-piperidine-1,3,5-tricarboxylate (CAS 175694-32-3) is a chemical compound with the molecular formula C17H21NO6 and a molecular weight of 335.4 g/mol. IUPAC name: 1-O-benzyl 3-O,5-O-dimethyl (3R,5S)-piperidine-1,3,5-tricarboxylate. InChIKey: JRNSRTLQWPKQIJ-OKILXGFUSA-N.
| Molecular formula | C17H21NO6 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 1-O-benzyl 3-O,5-O-dimethyl (3R,5S)-piperidine-1,3,5-tricarboxylate |
| InChIKey | JRNSRTLQWPKQIJ-OKILXGFUSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)