Products 1221818-73-0

CAS 1221818-73-0 is the registry number for 1-Benzyl 3,5-dimethyl piperidine-1,3,5-tricarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.

Structural formula: {0} (CAS {1})

1-O-benzyl 3-O,5-O-dimethyl piperidine-1,3,5-tricarboxylate (CAS 1221818-73-0) is a chemical compound with the molecular formula C17H21NO6 and a molecular weight of 335.4 g/mol. IUPAC name: 1-O-benzyl 3-O,5-O-dimethyl piperidine-1,3,5-tricarboxylate. InChIKey: JRNSRTLQWPKQIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H21NO6
Molecular weight335.4 g/mol
IUPAC name1-O-benzyl 3-O,5-O-dimethyl piperidine-1,3,5-tricarboxylate
InChIKeyJRNSRTLQWPKQIJ-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)