CAS 1026380-17-5 appears in our catalog under these names: Methyl 4-(4-(methoxycarbonyl)hepta-1,6-diyn-4-yl)benzoate, 98%, 98%, Plesafo impurity 2, 99.39%, Plesafo impurity 2 (Standard), Methyl 4-(4-(methoxycarbonyl)hepta-1,6-diyn-4-yl)benzoate, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 5 mg, 25 mg, 10 mg, 50 mg, 100 mg.
Methyl 4-(4-methoxycarbonylhepta-1,6-diyn-4-yl)benzoate (CAS 1026380-17-5) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: methyl 4-(4-methoxycarbonylhepta-1,6-diyn-4-yl)benzoate. InChIKey: XLNKCMVSYGASNC-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | methyl 4-(4-methoxycarbonylhepta-1,6-diyn-4-yl)benzoate |
| InChIKey | XLNKCMVSYGASNC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(CC#C)(CC#C)C(=O)OC |
Computed by PubChem (NCBI)