CAS 1026796-39-3 appears in our catalog under these names: (5–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)thiophen–2–yl)methanol, (5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methanol 98%, 5-Hydroxymethylthiophene-2-boronic acid pinacol ester, 98%, 98%, 5-Hydroxymethylthiophene-2-boronic acid pinacol ester, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methanol (CAS 1026796-39-3) is a chemical compound with the molecular formula C11H17BO3S and a molecular weight of 240.13 g/mol. IUPAC name: [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methanol. InChIKey: KWUMGVAXLIZGJS-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3S |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methanol |
| InChIKey | KWUMGVAXLIZGJS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CO |
Computed by PubChem (NCBI)