CAS 2121511-82-6 appears in our catalog under these names: (3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methanol, 95%, (3-(Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methanol (CAS 2121511-82-6) is a chemical compound with the molecular formula C11H17BO3S and a molecular weight of 240.13 g/mol. IUPAC name: [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methanol. InChIKey: IUICGXJAVAVYQQ-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3S |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methanol |
| InChIKey | IUICGXJAVAVYQQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)CO |
Computed by PubChem (NCBI)