CAS 1310384-98-5 appears in our catalog under these names: 2-(3-methoxy-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 3-Methoxythiophene-2-boronic acid pinacol ester, 98%, 3–Methoxythiophene–2–boronic acid pinacol ester, 3-Methoxythiophene-2-boronic acid pinacol ester, 2-(3-Methoxythiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%. Offered by: Chemat, Combi-blocks, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 2g, 10g, 50g.
2-(3-methoxythiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1310384-98-5) is a chemical compound with the molecular formula C11H17BO3S and a molecular weight of 240.13 g/mol. IUPAC name: 2-(3-methoxythiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FXKKXDGOIQJEJS-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3S |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2-(3-methoxythiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FXKKXDGOIQJEJS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)OC |
Computed by PubChem (NCBI)