Products 2073096-04-3
CAS 2073096-04-3 is the registry number for 2-(2-Methoxythiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2-methoxythiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2073096-04-3) is a chemical compound with the molecular formula C11H17BO3S and a molecular weight of 240.13 g/mol. IUPAC name: 2-(2-methoxythiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UFBFVWNPIAHXRY-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3S |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2-(2-methoxythiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UFBFVWNPIAHXRY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)OC |
Computed by PubChem (NCBI)