CAS 1310384-43-0 appears in our catalog under these names: 3-(Hydroxymethyl)thiophene-2-boronic acid pinacol ester, 95%, (2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl)methanol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g.
[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl]methanol (CAS 1310384-43-0) is a chemical compound with the molecular formula C11H17BO3S and a molecular weight of 240.13 g/mol. IUPAC name: [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl]methanol. InChIKey: LAGBITZYMDFUMF-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3S |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl]methanol |
| InChIKey | LAGBITZYMDFUMF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)CO |
Computed by PubChem (NCBI)