CAS 10270-94-7 appears in our catalog under these names: H–Dab(Boc)–OH, H-L-Dab(Boc)-OH, H-Dab(Boc)-OH 95%, (2S)-Amino-4-[(tert-butoxycarbonyl)amino]butanoic acid, 95%, 95%, H-Dab(Boc)-OH, 98.0%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 50g, 100g, 1 g.
(2S)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 10270-94-7) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: (2S)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: ICJFZQLAIOCZNG-LURJTMIESA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2S)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | ICJFZQLAIOCZNG-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)