CAS 114360-55-3 appears in our catalog under these names: H–D–Dab(Boc)–OH, H-D-Dab(Boc)-OH, H-D-4-Dab(Boc)-OH 97%, (2R)-2-Amino-4-[[(1,1-dimethylethoxy)carbonyl]amino]butanoic acid, 97%, 97%, Ng-Boc-D-2,4-diaminobutyric acid, 97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g, 100g.
(2R)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 114360-55-3) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: (2R)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: ICJFZQLAIOCZNG-ZCFIWIBFSA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2R)-2-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | ICJFZQLAIOCZNG-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)