Products 1027162-35-1
CAS 1027162-35-1 appears in our catalog under these names: Etoricoxib Impurity 18, 2-Methyl-5-(2-(4-(methylsulfonyl)phenyl)acetyl)pyridine 1-oxide, Etoricoxib Impurity, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 50mg.
1-(6-methyl-1-oxidopyridin-1-ium-3-yl)-2-(4-methylsulfonylphenyl)ethanone (CAS 1027162-35-1) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: 1-(6-methyl-1-oxidopyridin-1-ium-3-yl)-2-(4-methylsulfonylphenyl)ethanone. InChIKey: GVEGJGGIVOUSJV-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-(6-methyl-1-oxidopyridin-1-ium-3-yl)-2-(4-methylsulfonylphenyl)ethanone |
| InChIKey | GVEGJGGIVOUSJV-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=C(C=C1)C(=O)CC2=CC=C(C=C2)S(=O)(=O)C)[O-] |
Computed by PubChem (NCBI)