CAS 102725-59-7 appears in our catalog under these names: Diazepam Impurity 2, Diazepam Impurity 9, Diazepam Impurity 8, N-((5-Chloro-2-(methylamino)phenyl)phenylmethylene)glycine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[[5-chloro-2-(methylamino)phenyl]-phenylmethylidene]amino]acetic acid (CAS 102725-59-7) is a chemical compound with the molecular formula C16H15ClN2O2 and a molecular weight of 302.75 g/mol. IUPAC name: 2-[[[5-chloro-2-(methylamino)phenyl]-phenylmethylidene]amino]acetic acid. InChIKey: LUDKLGBTCGZHDX-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O2 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | 2-[[[5-chloro-2-(methylamino)phenyl]-phenylmethylidene]amino]acetic acid |
| InChIKey | LUDKLGBTCGZHDX-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)Cl)C(=NCC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)