Products 65267-29-0
CAS 65267-29-0 is the registry number for 7-Chloro-1,3,4,5-tetrahydro-4-hydroxy-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
7-chloro-4-hydroxy-1-methyl-5-phenyl-3,5-dihydro-1,4-benzodiazepin-2-one (CAS 65267-29-0) is a chemical compound with the molecular formula C16H15ClN2O2 and a molecular weight of 302.75 g/mol. IUPAC name: 7-chloro-4-hydroxy-1-methyl-5-phenyl-3,5-dihydro-1,4-benzodiazepin-2-one. InChIKey: NWKPFLVHSRDOHB-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O2 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | 7-chloro-4-hydroxy-1-methyl-5-phenyl-3,5-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | NWKPFLVHSRDOHB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN(C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)