CAS 36020-94-7 appears in our catalog under these names: Diazepam Impurity 7, Diazepam Impurity 1, Diazepam Impurity 8, 2-Amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide. Offered by: Hubei YoungXin, Chemat Brand, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
2-amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide (CAS 36020-94-7) is a chemical compound with the molecular formula C16H15ClN2O2 and a molecular weight of 302.75 g/mol. IUPAC name: 2-amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide. InChIKey: HQJSGBKPXYZTRN-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O2 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | 2-amino-N-(2-benzoyl-4-chlorophenyl)-N-methylacetamide |
| InChIKey | HQJSGBKPXYZTRN-UHFFFAOYSA-N |
| SMILES | CN(C1=C(C=C(C=C1)Cl)C(=O)C2=CC=CC=C2)C(=O)CN |
Computed by PubChem (NCBI)