CAS 909370-76-9 is the registry number for N'-(Chloroacetyl)-2,2-diphenylacetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N'-(2-chloroacetyl)-2,2-diphenylacetohydrazide (CAS 909370-76-9) is a chemical compound with the molecular formula C16H15ClN2O2 and a molecular weight of 302.75 g/mol. IUPAC name: N'-(2-chloroacetyl)-2,2-diphenylacetohydrazide. InChIKey: CXAMXCRTIAIZOW-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O2 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | N'-(2-chloroacetyl)-2,2-diphenylacetohydrazide |
| InChIKey | CXAMXCRTIAIZOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NNC(=O)CCl |
Computed by PubChem (NCBI)