CAS 1803609-27-9 appears in our catalog under these names: 3-(2-Chloroacetamido)-4-methyl-N-phenylbenzamide, 95%, 3-(2-Chloroacetamido)-4-methyl-N-phenylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-[(2-chloroacetyl)amino]-4-methyl-N-phenylbenzamide (CAS 1803609-27-9) is a chemical compound with the molecular formula C16H15ClN2O2 and a molecular weight of 302.75 g/mol. IUPAC name: 3-[(2-chloroacetyl)amino]-4-methyl-N-phenylbenzamide. InChIKey: HSYQNSHSHURABJ-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O2 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | 3-[(2-chloroacetyl)amino]-4-methyl-N-phenylbenzamide |
| InChIKey | HSYQNSHSHURABJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CC=CC=C2)NC(=O)CCl |
Computed by PubChem (NCBI)