CAS 102735-85-3 appears in our catalog under these names: 4-Chloro-3-(1H)indazole carboxaldehyde, 4-Chloro-1H-indazole-3-carbaldehyde, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g, 1g.
4-chloro-2H-indazole-3-carbaldehyde (CAS 102735-85-3) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 4-chloro-2H-indazole-3-carbaldehyde. InChIKey: INZGVVZFYFGKJE-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 4-chloro-2H-indazole-3-carbaldehyde |
| InChIKey | INZGVVZFYFGKJE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)Cl)C=O |
Computed by PubChem (NCBI)