CAS 102735-88-6 is the registry number for 5-Fluoro-2-methyl-1,3-dinitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
5-fluoro-2-methyl-1,3-dinitrobenzene (CAS 102735-88-6) is a chemical compound with the molecular formula C7H5FN2O4 and a molecular weight of 200.12 g/mol. IUPAC name: 5-fluoro-2-methyl-1,3-dinitrobenzene. InChIKey: GLIDVOGSKCTART-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O4 |
|---|---|
| Molecular weight | 200.12 g/mol |
| IUPAC name | 5-fluoro-2-methyl-1,3-dinitrobenzene |
| InChIKey | GLIDVOGSKCTART-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])F)[N+](=O)[O-] |
Computed by PubChem (NCBI)