CAS 1027407-75-5 appears in our catalog under these names: Nintedanib Impurity 15, Nintedanib Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3Z)-1-acetyl-3-[ethoxy(phenyl)methylidene]-2-oxoindole-6-carboxylate (CAS 1027407-75-5) is a chemical compound with the molecular formula C21H19NO5 and a molecular weight of 365.4 g/mol. IUPAC name: methyl (3Z)-1-acetyl-3-[ethoxy(phenyl)methylidene]-2-oxoindole-6-carboxylate. InChIKey: NSLGYOTXIPMWNZ-HNENSFHCSA-N.
| Molecular formula | C21H19NO5 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | methyl (3Z)-1-acetyl-3-[ethoxy(phenyl)methylidene]-2-oxoindole-6-carboxylate |
| InChIKey | NSLGYOTXIPMWNZ-HNENSFHCSA-N |
| SMILES | CCO/C(=C\1/C2=C(C=C(C=C2)C(=O)OC)N(C1=O)C(=O)C)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)