Products 1802937-26-3

CAS 1802937-26-3 is the registry number for JP-153, 99.45%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg.

Structural formula: {0} (CAS {1})

4-(3,4,5-trimethoxyphenyl)-1,4-dihydrobenzo[h][3,1]benzoxazin-2-one (CAS 1802937-26-3) is a chemical compound with the molecular formula C21H19NO5 and a molecular weight of 365.4 g/mol. IUPAC name: 4-(3,4,5-trimethoxyphenyl)-1,4-dihydrobenzo[h][3,1]benzoxazin-2-one. InChIKey: NIDMIFDHMDRHLS-UHFFFAOYSA-N.

Identity
Molecular formulaC21H19NO5
Molecular weight365.4 g/mol
IUPAC name4-(3,4,5-trimethoxyphenyl)-1,4-dihydrobenzo[h][3,1]benzoxazin-2-one
InChIKeyNIDMIFDHMDRHLS-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C2C3=C(C4=CC=CC=C4C=C3)NC(=O)O2

Computed by PubChem (NCBI)

Synonyms: orb1568337, orb3028685