CAS 728878-11-3 is the registry number for Methyl (4-((4-formylphenyl)ethynyl)benzoyl)-L-threoninate, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
Methyl (2S,3R)-2-[[4-[2-(4-formylphenyl)ethynyl]benzoyl]amino]-3-hydroxybutanoate (CAS 728878-11-3) is a chemical compound with the molecular formula C21H19NO5 and a molecular weight of 365.4 g/mol. IUPAC name: methyl (2S,3R)-2-[[4-[2-(4-formylphenyl)ethynyl]benzoyl]amino]-3-hydroxybutanoate. InChIKey: QJNKHEDLSQWBLA-KUHUBIRLSA-N.
| Molecular formula | C21H19NO5 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | methyl (2S,3R)-2-[[4-[2-(4-formylphenyl)ethynyl]benzoyl]amino]-3-hydroxybutanoate |
| InChIKey | QJNKHEDLSQWBLA-KUHUBIRLSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)C1=CC=C(C=C1)C#CC2=CC=C(C=C2)C=O)O |
Computed by PubChem (NCBI)