CAS 1221793-43-6 appears in our catalog under these names: Fmoc-l-homopro(4-oxo)-oh, 95%, Fmoc-HoPro(4-oxo)-OH 97%, FMOC-L-HOMOPRO(4-OXO), 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-oxopiperidine-2-carboxylic acid (CAS 1221793-43-6) is a chemical compound with the molecular formula C21H19NO5 and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-oxopiperidine-2-carboxylic acid. InChIKey: YGAHCGORXONSSM-IBGZPJMESA-N.
| Molecular formula | C21H19NO5 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-oxopiperidine-2-carboxylic acid |
| InChIKey | YGAHCGORXONSSM-IBGZPJMESA-N |
| SMILES | C1CN([C@@H](CC1=O)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)