Products 1201816-68-3
CAS 1201816-68-3 is the registry number for 1-(4-Ethoxyphenyl)-5-(2-hydroxy-4-methoxybenzoyl)-2(1H)-pyridinone. Offered by: TRC. Available pack sizes: 250mg.
1-(4-ethoxyphenyl)-5-(2-hydroxy-4-methoxybenzoyl)pyridin-2-one (CAS 1201816-68-3) is a chemical compound with the molecular formula C21H19NO5 and a molecular weight of 365.4 g/mol. IUPAC name: 1-(4-ethoxyphenyl)-5-(2-hydroxy-4-methoxybenzoyl)pyridin-2-one. InChIKey: UFPXXSPJUBYJGF-UHFFFAOYSA-N.
| Molecular formula | C21H19NO5 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 1-(4-ethoxyphenyl)-5-(2-hydroxy-4-methoxybenzoyl)pyridin-2-one |
| InChIKey | UFPXXSPJUBYJGF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C=C(C=CC2=O)C(=O)C3=C(C=C(C=C3)OC)O |
Computed by PubChem (NCBI)