Products 1027512-91-9

CAS 1027512-91-9 is the registry number for 2-Amino-3,5-dibromo-4-fluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-amino-3,5-dibromo-4-fluorobenzoic acid (CAS 1027512-91-9) is a chemical compound with the molecular formula C7H4Br2FNO2 and a molecular weight of 312.92 g/mol. IUPAC name: 2-amino-3,5-dibromo-4-fluorobenzoic acid. InChIKey: FCDUVODEYZAMHX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4Br2FNO2
Molecular weight312.92 g/mol
IUPAC name2-amino-3,5-dibromo-4-fluorobenzoic acid
InChIKeyFCDUVODEYZAMHX-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1Br)F)Br)N)C(=O)O

Computed by PubChem (NCBI)