Products 1807263-67-7
CAS 1807263-67-7 is the registry number for 1-Bromo-2-(bromomethyl)-4-fluoro-5-nitrobenzene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-2-(bromomethyl)-4-fluoro-5-nitrobenzene (CAS 1807263-67-7) is a chemical compound with the molecular formula C7H4Br2FNO2 and a molecular weight of 312.92 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-4-fluoro-5-nitrobenzene. InChIKey: FOIZEELKCQJUEO-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2FNO2 |
|---|---|
| Molecular weight | 312.92 g/mol |
| IUPAC name | 1-bromo-2-(bromomethyl)-4-fluoro-5-nitrobenzene |
| InChIKey | FOIZEELKCQJUEO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])Br)CBr |
Computed by PubChem (NCBI)