Products 1379295-27-8
CAS 1379295-27-8 appears in our catalog under these names: 4-Bromo-2-fluoro-5-nitrobenzyl bromide, 95%, 4-Bromo-2-fluoro-5-nitrobenzyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-bromo-4-(bromomethyl)-5-fluoro-2-nitrobenzene (CAS 1379295-27-8) is a chemical compound with the molecular formula C7H4Br2FNO2 and a molecular weight of 312.92 g/mol. IUPAC name: 1-bromo-4-(bromomethyl)-5-fluoro-2-nitrobenzene. InChIKey: XRVLPLOHBUOFQA-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2FNO2 |
|---|---|
| Molecular weight | 312.92 g/mol |
| IUPAC name | 1-bromo-4-(bromomethyl)-5-fluoro-2-nitrobenzene |
| InChIKey | XRVLPLOHBUOFQA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)F)CBr |
Computed by PubChem (NCBI)