Products 1820613-94-2
CAS 1820613-94-2 is the registry number for 1,3-Dibromo-4-fluoro-2-methyl-5-nitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3-dibromo-4-fluoro-2-methyl-5-nitrobenzene (CAS 1820613-94-2) is a chemical compound with the molecular formula C7H4Br2FNO2 and a molecular weight of 312.92 g/mol. IUPAC name: 1,3-dibromo-4-fluoro-2-methyl-5-nitrobenzene. InChIKey: IEDUCLXNKAWOGT-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2FNO2 |
|---|---|
| Molecular weight | 312.92 g/mol |
| IUPAC name | 1,3-dibromo-4-fluoro-2-methyl-5-nitrobenzene |
| InChIKey | IEDUCLXNKAWOGT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Br)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)