Products 1807120-19-9
CAS 1807120-19-9 appears in our catalog under these names: 2-Bromo-5-fluoro-3-nitrobenzyl bromide, 95%, 2-Bromo-1-(bromomethyl)-5-fluoro-3-nitrobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-bromo-1-(bromomethyl)-5-fluoro-3-nitrobenzene (CAS 1807120-19-9) is a chemical compound with the molecular formula C7H4Br2FNO2 and a molecular weight of 312.92 g/mol. IUPAC name: 2-bromo-1-(bromomethyl)-5-fluoro-3-nitrobenzene. InChIKey: PTKTUCLNNJGCEG-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2FNO2 |
|---|---|
| Molecular weight | 312.92 g/mol |
| IUPAC name | 2-bromo-1-(bromomethyl)-5-fluoro-3-nitrobenzene |
| InChIKey | PTKTUCLNNJGCEG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CBr)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)