CAS 1027513-93-4 appears in our catalog under these names: 2,2-Difluoro-2-(3-fluoro-4-methoxyphenyl)acetic acid, 95%, 2,2-Difluoro-2-(3-fluoro-4-methoxyphenyl)acetic acid, 98%, 98%, 2,2-Difluoro-2-(3-fluoro-4-methoxyphenyl)acetic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 1g, 250mg, 500mg, 2.5g.
2,2-difluoro-2-(3-fluoro-4-methoxyphenyl)acetic acid (CAS 1027513-93-4) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2,2-difluoro-2-(3-fluoro-4-methoxyphenyl)acetic acid. InChIKey: JIQAVAXAYWMZOL-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2,2-difluoro-2-(3-fluoro-4-methoxyphenyl)acetic acid |
| InChIKey | JIQAVAXAYWMZOL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(=O)O)(F)F)F |
Computed by PubChem (NCBI)