CAS 1027643-30-6 appears in our catalog under these names: 2-(2-Pyrrolidinyl)-1,3-benzothiazole hydrochloride, 95%, 2-(Pyrrolidin-2-yl)benzo(d)thiazole hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
2-pyrrolidin-2-yl-1,3-benzothiazole;hydrochloride (CAS 1027643-30-6) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: 2-pyrrolidin-2-yl-1,3-benzothiazole;hydrochloride. InChIKey: QGZFWPSLMFCWIL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | 2-pyrrolidin-2-yl-1,3-benzothiazole;hydrochloride |
| InChIKey | QGZFWPSLMFCWIL-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=NC3=CC=CC=C3S2.Cl |
Computed by PubChem (NCBI)