CAS 123941-49-1 appears in our catalog under these names: Xylazole, 95%, Xylazole hydrochloride, Xylazole hydrochloride. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
N-(2,6-dimethylphenyl)-1,3-thiazol-2-amine;hydrochloride (CAS 123941-49-1) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: HCHSCHUMEPRVGC-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | HCHSCHUMEPRVGC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=NC=CS2.Cl |
Computed by PubChem (NCBI)