CAS 859469-67-3 is the registry number for 5-Ethyl-4-phenyl-1,3-thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5-ethyl-4-phenyl-1,3-thiazol-2-amine;hydrochloride (CAS 859469-67-3) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: 5-ethyl-4-phenyl-1,3-thiazol-2-amine;hydrochloride. InChIKey: XCRIHCPCZVEMBX-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | 5-ethyl-4-phenyl-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | XCRIHCPCZVEMBX-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(S1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)