CAS 124534-88-9 appears in our catalog under these names: 2-(4-Phenyl-1,3-thiazol-2-yl)ethan-1-amine hydrochloride, 95%, 4-Phenyl-2-thiazoleethanamine Hydrochloride, 2-(4-Phenylthiazol-2-yl)ethanamine hydrochloride, 95+%, 2-(4-Phenyl-thiazol-2-yl)-ethylamine hydrochloride. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 25g, 10g, 5g, 1g, 2,5g.
2-(4-phenyl-1,3-thiazol-2-yl)ethanamine;hydrochloride (CAS 124534-88-9) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: 2-(4-phenyl-1,3-thiazol-2-yl)ethanamine;hydrochloride. InChIKey: CONWWOZXJJXGGO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | 2-(4-phenyl-1,3-thiazol-2-yl)ethanamine;hydrochloride |
| InChIKey | CONWWOZXJJXGGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CCN.Cl |
Computed by PubChem (NCBI)